CAS 1269789-01-6 appears in our catalog under these names: Carbidopa Impurity 27, Methyldopa Impurity 3, (S)-2-Amino-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic acid (CAS 1269789-01-6) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: (2S)-2-amino-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic acid. InChIKey: JAUGARVILMTSKZ-NSHDSACASA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic acid |
| InChIKey | JAUGARVILMTSKZ-NSHDSACASA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)OC)O)(C(=O)O)N |
Computed by PubChem (NCBI)