CAS 1270039-30-9 is the registry number for H-L-Phe(3-OBzl)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-2-amino-3-(3-phenylmethoxyphenyl)propanoic acid (CAS 1270039-30-9) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: (2S)-2-amino-3-(3-phenylmethoxyphenyl)propanoic acid. InChIKey: IHRFLYKCDZFCHW-HNNXBMFYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-phenylmethoxyphenyl)propanoic acid |
| InChIKey | IHRFLYKCDZFCHW-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)