Products 1270990-47-0
CAS 1270990-47-0 is the registry number for 2-(2-Naphthalenyl)-4-oxazolecarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-naphthalen-2-yl-1,3-oxazole-4-carboxylic acid (CAS 1270990-47-0) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 2-naphthalen-2-yl-1,3-oxazole-4-carboxylic acid. InChIKey: BMCVPRLKFPYPST-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 2-naphthalen-2-yl-1,3-oxazole-4-carboxylic acid |
| InChIKey | BMCVPRLKFPYPST-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NC(=CO3)C(=O)O |
Computed by PubChem (NCBI)