CAS 127168-93-8 appears in our catalog under these names: Methyl Isoindoline-5-carboxylate Hydrochloride, Methyl isoindoline–5–carboxylate hydrochloride, Methyl isoindoline-5-carboxylate HCl, Methyl isoindoline-5-carboxylate hydrochloride 98%, Methyl Isoindoline-5-Carboxylate Hydrochloride, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 750mg, 100mg, 2g, 5g, 250mg, 1g, 10g, 25g.
Methyl 2,3-dihydro-1H-isoindole-5-carboxylate;hydrochloride (CAS 127168-93-8) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 2,3-dihydro-1H-isoindole-5-carboxylate;hydrochloride. InChIKey: UCJNRYHJEDJKAI-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | methyl 2,3-dihydro-1H-isoindole-5-carboxylate;hydrochloride |
| InChIKey | UCJNRYHJEDJKAI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CNC2)C=C1.Cl |
Computed by PubChem (NCBI)