CAS 1272519-91-1 is the registry number for (Z)-5-(4-Methoxybenzylidene)-2-phenylthiazol-4(5H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(5Z)-5-[(4-methoxyphenyl)methylidene]-2-phenyl-1,3-thiazol-4-one (CAS 1272519-91-1) is a chemical compound with the molecular formula C17H13NO2S and a molecular weight of 295.4 g/mol. IUPAC name: (5Z)-5-[(4-methoxyphenyl)methylidene]-2-phenyl-1,3-thiazol-4-one. InChIKey: XJDDNBQXWPCSCW-PTNGSMBKSA-N.
| Molecular formula | C17H13NO2S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | (5Z)-5-[(4-methoxyphenyl)methylidene]-2-phenyl-1,3-thiazol-4-one |
| InChIKey | XJDDNBQXWPCSCW-PTNGSMBKSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C\2/C(=O)N=C(S2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)