Products 861070-30-6
CAS 861070-30-6 is the registry number for 5-phenyl-2-(phenylsulfonyl)penta-2,4-dienenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-(benzenesulfonyl)-5-phenylpenta-2,4-dienenitrile (CAS 861070-30-6) is a chemical compound with the molecular formula C17H13NO2S and a molecular weight of 295.4 g/mol. IUPAC name: 2-(benzenesulfonyl)-5-phenylpenta-2,4-dienenitrile. InChIKey: UWAWRDPLMNQNIH-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 2-(benzenesulfonyl)-5-phenylpenta-2,4-dienenitrile |
| InChIKey | UWAWRDPLMNQNIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=CC=C(C#N)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)