Products 1329538-16-0

CAS 1329538-16-0 is the registry number for 2-Benzyl-4-phenyl-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-benzyl-4-phenyl-1,3-thiazole-5-carboxylic acid (CAS 1329538-16-0) is a chemical compound with the molecular formula C17H13NO2S and a molecular weight of 295.4 g/mol. IUPAC name: 2-benzyl-4-phenyl-1,3-thiazole-5-carboxylic acid. InChIKey: MKDPSENJELZGTK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO2S
Molecular weight295.4 g/mol
IUPAC name2-benzyl-4-phenyl-1,3-thiazole-5-carboxylic acid
InChIKeyMKDPSENJELZGTK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC2=NC(=C(S2)C(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)