CAS 1329538-16-0 is the registry number for 2-Benzyl-4-phenyl-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-benzyl-4-phenyl-1,3-thiazole-5-carboxylic acid (CAS 1329538-16-0) is a chemical compound with the molecular formula C17H13NO2S and a molecular weight of 295.4 g/mol. IUPAC name: 2-benzyl-4-phenyl-1,3-thiazole-5-carboxylic acid. InChIKey: MKDPSENJELZGTK-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 2-benzyl-4-phenyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | MKDPSENJELZGTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=C(S2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)