Products 2056899-56-8
CAS 2056899-56-8 is the registry number for (E)-HBT-O. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-4-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]but-3-en-2-one (CAS 2056899-56-8) is a chemical compound with the molecular formula C17H13NO2S and a molecular weight of 295.4 g/mol. IUPAC name: (E)-4-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]but-3-en-2-one. InChIKey: CSYIZCNFOUDSAY-VOTSOKGWSA-N.
| Molecular formula | C17H13NO2S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | (E)-4-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]but-3-en-2-one |
| InChIKey | CSYIZCNFOUDSAY-VOTSOKGWSA-N |
| SMILES | CC(=O)/C=C/C1=CC(=C(C=C1)O)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)