Products 875419-53-7
CAS 875419-53-7 is the registry number for 9-Phenyl-2H,3H-(1,4)dioxino(2,3-G)quinoline-7-thiol. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
9-phenyl-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinoline-7-thione (CAS 875419-53-7) is a chemical compound with the molecular formula C17H13NO2S and a molecular weight of 295.4 g/mol. IUPAC name: 9-phenyl-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinoline-7-thione. InChIKey: MKGMUPKDUUQJPJ-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 9-phenyl-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinoline-7-thione |
| InChIKey | MKGMUPKDUUQJPJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C3C(=CC(=S)NC3=C2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)