CAS 1351474-54-8 appears in our catalog under these names: Benzo[d]thiazol-2-ylmethyl cinnamate, ≥95%, ≥95%, Benzo[d]thiazol-2-ylmethyl cinnamate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 100mg, 250mg, 500mg, 1g.
1,3-benzothiazol-2-ylmethyl (E)-3-phenylprop-2-enoate (CAS 1351474-54-8) is a chemical compound with the molecular formula C17H13NO2S and a molecular weight of 295.4 g/mol. IUPAC name: 1,3-benzothiazol-2-ylmethyl (E)-3-phenylprop-2-enoate. InChIKey: QTGSIECPXQDTFE-ZHACJKMWSA-N.
| Molecular formula | C17H13NO2S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 1,3-benzothiazol-2-ylmethyl (E)-3-phenylprop-2-enoate |
| InChIKey | QTGSIECPXQDTFE-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)OCC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)