Products 21256-15-5
CAS 21256-15-5 appears in our catalog under these names: 2-(2,4-Diphenyl-1,3-thiazol-5-yl)acetic acid, 95%, 2-(2,4-Diphenylthiazol-5-yl)acetic acid, 95+%, 2-(2,4-Diphenylthiazol-5-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-(2,4-diphenyl-1,3-thiazol-5-yl)acetic acid (CAS 21256-15-5) is a chemical compound with the molecular formula C17H13NO2S and a molecular weight of 295.4 g/mol. IUPAC name: 2-(2,4-diphenyl-1,3-thiazol-5-yl)acetic acid. InChIKey: WNGOHXAHAKLKAR-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 2-(2,4-diphenyl-1,3-thiazol-5-yl)acetic acid |
| InChIKey | WNGOHXAHAKLKAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)C3=CC=CC=C3)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(2,4-diphenyl-1,3-thiazol-5-yl)acetic acid, 2-(2,4-diphenylthiazol-5-yl)acetic acid, Bionet2_000936, Oprea1_148343, 2,4-Diphenyl-5-thiazoleacetic acid, 5-Thiazoleacetic acid, 2,4-diphenyl-, 2-(2,4-diphenylthiazol-5-yl)aceticacid, 2-(2,4-Diphenyl-1,3-thiazol-5-yl)ethanoic acid, 2-(2,4-diphenyl-1,3-thiazol-5-yl)acetic acid, AldrichCPR