Products 1272667-21-6

CAS 1272667-21-6 is the registry number for tert-Butyl 1,4-thiazepane-4-carboxylate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Tert-butyl 1,1-dioxo-1,4-thiazepane-4-carboxylate (CAS 1272667-21-6) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: tert-butyl 1,1-dioxo-1,4-thiazepane-4-carboxylate. InChIKey: JBMOPYJGTNUCOB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO4S
Molecular weight249.33 g/mol
IUPAC nametert-butyl 1,1-dioxo-1,4-thiazepane-4-carboxylate
InChIKeyJBMOPYJGTNUCOB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCS(=O)(=O)CC1

Computed by PubChem (NCBI)