CAS 1276055-49-2 appears in our catalog under these names: (S)–2–(Aminomethyl)–4–methylpentanoic acid hydrochloride, (S)-2-(Aminomethyl)-4-methylpentanoic acid hydrochloride, 95%, (S)-2-(aminomethyl)-4-methylpentanoic acid-HCl, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg.
(2S)-2-(aminomethyl)-4-methylpentanoic acid;hydrochloride (CAS 1276055-49-2) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (2S)-2-(aminomethyl)-4-methylpentanoic acid;hydrochloride. InChIKey: HZQWRYHUNMXMLF-RGMNGODLSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (2S)-2-(aminomethyl)-4-methylpentanoic acid;hydrochloride |
| InChIKey | HZQWRYHUNMXMLF-RGMNGODLSA-N |
| SMILES | CC(C)C[C@@H](CN)C(=O)O.Cl |
Computed by PubChem (NCBI)