Products 1276197-40-0
CAS 1276197-40-0 appears in our catalog under these names: Phthalic Acid Monomethyl Ester-D4, Monomethyl Phthalate-d4, >95% (HPLC), mono-Methyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Monomethyl phthalate–d4, Monomethyl phthalate-d4, 99.04%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 0,1g, 0,05g, 1mg, 5mg, 1 mg.
2,3,4,5-tetradeuterio-6-methoxycarbonylbenzoic acid (CAS 1276197-40-0) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 184.18 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-methoxycarbonylbenzoic acid. InChIKey: FNJSWIPFHMKRAT-QFFDRWTDSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-methoxycarbonylbenzoic acid |
| InChIKey | FNJSWIPFHMKRAT-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OC)[2H])[2H] |
Computed by PubChem (NCBI)