Products 1276379-68-0
CAS 1276379-68-0 appears in our catalog under these names: Dansyl Chloride-d6, Dansyl-d6 Chloride (N,N-dimethyl-d6), 99 atom % D, min 95% Chemical Purity, Dansyl chloride–d6, Dansyl chloride-d6, 99.47%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 250mg, 50mg, 0,05g, 0,01g, 1mg, 5mg, 1 mg.
5-[bis(trideuteriomethyl)amino]naphthalene-1-sulfonyl chloride (CAS 1276379-68-0) is a chemical compound with the molecular formula C12H12ClNO2S and a molecular weight of 275.78 g/mol. IUPAC name: 5-[bis(trideuteriomethyl)amino]naphthalene-1-sulfonyl chloride. InChIKey: XPDXVDYUQZHFPV-WFGJKAKNSA-N.
| Molecular formula | C12H12ClNO2S |
|---|---|
| Molecular weight | 275.78 g/mol |
| IUPAC name | 5-[bis(trideuteriomethyl)amino]naphthalene-1-sulfonyl chloride |
| InChIKey | XPDXVDYUQZHFPV-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C1=CC=CC2=C1C=CC=C2S(=O)(=O)Cl)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)