Products 1978063-82-9

CAS 1978063-82-9 is the registry number for 3-(7-Chloro-1H-indol-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(7-chloroindol-1-yl)thiolane 1,1-dioxide (CAS 1978063-82-9) is a chemical compound with the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. IUPAC name: 3-(7-chloroindol-1-yl)thiolane 1,1-dioxide. InChIKey: GSUJRDYYLKXCNX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12ClNO2S
Molecular weight269.75 g/mol
IUPAC name3-(7-chloroindol-1-yl)thiolane 1,1-dioxide
InChIKeyGSUJRDYYLKXCNX-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1N2C=CC3=C2C(=CC=C3)Cl

Computed by PubChem (NCBI)