CAS 900640-86-0 is the registry number for 4-(Chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-thiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
4-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-thiazole (CAS 900640-86-0) is a chemical compound with the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. IUPAC name: 4-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-thiazole. InChIKey: VSGHNBRTGHXMCU-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2S |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-thiazole |
| InChIKey | VSGHNBRTGHXMCU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=NC(=CS2)CCl)OC |
Computed by PubChem (NCBI)