Products 900640-86-0

CAS 900640-86-0 is the registry number for 4-(Chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-thiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-thiazole (CAS 900640-86-0) is a chemical compound with the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. IUPAC name: 4-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-thiazole. InChIKey: VSGHNBRTGHXMCU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12ClNO2S
Molecular weight269.75 g/mol
IUPAC name4-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-thiazole
InChIKeyVSGHNBRTGHXMCU-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C2=NC(=CS2)CCl)OC

Computed by PubChem (NCBI)