CAS 2567503-42-6 is the registry number for Methyl 3-amino-4-phenylthiophene-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 3-amino-4-phenylthiophene-2-carboxylate;hydrochloride (CAS 2567503-42-6) is a chemical compound with the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. IUPAC name: methyl 3-amino-4-phenylthiophene-2-carboxylate;hydrochloride. InChIKey: SJOACPVXHKIZEX-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2S |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | methyl 3-amino-4-phenylthiophene-2-carboxylate;hydrochloride |
| InChIKey | SJOACPVXHKIZEX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CS1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)