Products 60151-27-1

CAS 60151-27-1 appears in our catalog under these names: 6-(Dimethylamino)naphthalene-2-sulfonyl chloride, 97%, 2-Dimethylaminonaphthalene-6-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,25g, 0,1g, 0,5g.

6-(dimethylamino)naphthalene-2-sulfonyl chloride (CAS 60151-27-1) is a chemical compound with the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. IUPAC name: 6-(dimethylamino)naphthalene-2-sulfonyl chloride. InChIKey: QJKFMFKDDZRROW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12ClNO2S
Molecular weight269.75 g/mol
IUPAC name6-(dimethylamino)naphthalene-2-sulfonyl chloride
InChIKeyQJKFMFKDDZRROW-UHFFFAOYSA-N
SMILESCN(C)C1=CC2=C(C=C1)C=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)