Products 274250-28-1
CAS 274250-28-1 is the registry number for Ginsenoside rc. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
5-[di((113C)methyl)amino]naphthalene-1-sulfonyl chloride (CAS 274250-28-1) is a chemical compound with the molecular formula C12H12ClNO2S and a molecular weight of 271.73 g/mol. IUPAC name: 5-[di((113C)methyl)amino]naphthalene-1-sulfonyl chloride. InChIKey: XPDXVDYUQZHFPV-ZDOIIHCHSA-N.
| Molecular formula | C12H12ClNO2S |
|---|---|
| Molecular weight | 271.73 g/mol |
| IUPAC name | 5-[di((113C)methyl)amino]naphthalene-1-sulfonyl chloride |
| InChIKey | XPDXVDYUQZHFPV-ZDOIIHCHSA-N |
| SMILES | [13CH3]N([13CH3])C1=CC=CC2=C1C=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)