CAS 1354951-94-2 appears in our catalog under these names: 3-((2-Methyl-1,3-thiazol-5-yl)methyl)benzoic acid hydrochloride, 95%, 3-((2-Methyl-1,3-thiazol-5-yl)methyl)benzoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[(2-methyl-1,3-thiazol-5-yl)methyl]benzoic acid;hydrochloride (CAS 1354951-94-2) is a chemical compound with the molecular formula C12H12ClNO2S and a molecular weight of 269.75 g/mol. IUPAC name: 3-[(2-methyl-1,3-thiazol-5-yl)methyl]benzoic acid;hydrochloride. InChIKey: KORSDNMEDVBTBZ-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2S |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | 3-[(2-methyl-1,3-thiazol-5-yl)methyl]benzoic acid;hydrochloride |
| InChIKey | KORSDNMEDVBTBZ-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(S1)CC2=CC(=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)