Products 1278585-68-4
CAS 1278585-68-4 appears in our catalog under these names: Dronedarone Impurity 7, (5-Amino-2-butylbenzofuran-3-yl)(4-hydroxyphenyl)methanone, 95%, Dronedarone C. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 50mg.
(5-amino-2-butyl-1-benzofuran-3-yl)-(4-hydroxyphenyl)methanone (CAS 1278585-68-4) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: (5-amino-2-butyl-1-benzofuran-3-yl)-(4-hydroxyphenyl)methanone. InChIKey: ZBSCIIGOYCSAQV-UHFFFAOYSA-N.
| Molecular formula | C19H19NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (5-amino-2-butyl-1-benzofuran-3-yl)-(4-hydroxyphenyl)methanone |
| InChIKey | ZBSCIIGOYCSAQV-UHFFFAOYSA-N |
| SMILES | CCCCC1=C(C2=C(O1)C=CC(=C2)N)C(=O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)