Products 220141-20-8

CAS 220141-20-8 is the registry number for Methyl 2-chloro-4-(1h-1,2,4-triazol-1-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-chloro-4-(1,2,4-triazol-1-yl)benzoate (CAS 220141-20-8) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: methyl 2-chloro-4-(1,2,4-triazol-1-yl)benzoate. InChIKey: LWJWMJWSQGGXPO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClN3O2
Molecular weight237.64 g/mol
IUPAC namemethyl 2-chloro-4-(1,2,4-triazol-1-yl)benzoate
InChIKeyLWJWMJWSQGGXPO-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)N2C=NC=N2)Cl

Computed by PubChem (NCBI)