CAS 220141-20-8 is the registry number for Methyl 2-chloro-4-(1h-1,2,4-triazol-1-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-chloro-4-(1,2,4-triazol-1-yl)benzoate (CAS 220141-20-8) is a chemical compound with the molecular formula C10H8ClN3O2 and a molecular weight of 237.64 g/mol. IUPAC name: methyl 2-chloro-4-(1,2,4-triazol-1-yl)benzoate. InChIKey: LWJWMJWSQGGXPO-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3O2 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | methyl 2-chloro-4-(1,2,4-triazol-1-yl)benzoate |
| InChIKey | LWJWMJWSQGGXPO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N2C=NC=N2)Cl |
Computed by PubChem (NCBI)