CAS 127972-17-2 appears in our catalog under these names: 2-Benzyloxy-5-methylphenylboronic acid, 97%, 97%, (2-(Benzyloxy)-5-methylphenyl)boronic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(5-methyl-2-phenylmethoxyphenyl)boronic acid (CAS 127972-17-2) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: (5-methyl-2-phenylmethoxyphenyl)boronic acid. InChIKey: AMBDTEZABFLVAD-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | (5-methyl-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | AMBDTEZABFLVAD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)