CAS 1283109-30-7 is the registry number for 2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxylic acid (CAS 1283109-30-7) is a chemical compound with the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. IUPAC name: 2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxylic acid. InChIKey: ATSIABWQQQSHQB-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2S |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | 2-(pyrimidin-2-ylamino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | ATSIABWQQQSHQB-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)NC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)