Products 79318-07-3
CAS 79318-07-3 is the registry number for (Z)-3-((1H-Purin-6-yl)thio)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-3-(7H-purin-6-ylsulfanyl)prop-2-enoic acid (CAS 79318-07-3) is a chemical compound with the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. IUPAC name: (Z)-3-(7H-purin-6-ylsulfanyl)prop-2-enoic acid. InChIKey: JFBVDMIUMQUOAC-UPHRSURJSA-N.
| Molecular formula | C8H6N4O2S |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | (Z)-3-(7H-purin-6-ylsulfanyl)prop-2-enoic acid |
| InChIKey | JFBVDMIUMQUOAC-UPHRSURJSA-N |
| SMILES | C1=NC2=C(N1)C(=NC=N2)S/C=C\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(Z)-3-((1H-Purin-6-yl)thio)acrylic acid