CAS 23249-95-8 appears in our catalog under these names: 4-(5-Mercapto-1H-tetrazol-1-yl)benzoic acid, 95%+(HPLC),RG, 95%+(HPLC),RG, 1–(4–Carboxyphenyl)–5–mercapto–1H–tetrazole, 1-(4-Carboxyphenyl)-5-mercapto-1H-tetrazole, >95.0%(HPLC)(T). Offered by: Chemat, GLPBio, TCI. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(5-sulfanylidene-2H-tetrazol-1-yl)benzoic acid (CAS 23249-95-8) is a chemical compound with the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. IUPAC name: 4-(5-sulfanylidene-2H-tetrazol-1-yl)benzoic acid. InChIKey: GDVFHEXRJFFDDB-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2S |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | 4-(5-sulfanylidene-2H-tetrazol-1-yl)benzoic acid |
| InChIKey | GDVFHEXRJFFDDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C(=S)N=NN2 |
Computed by PubChem (NCBI)