CAS 833-63-6 appears in our catalog under these names: 5-(4-Nitro-phenyl)-(1,3,4)thiadiazol-2-ylamine, 5-(4-Nitrophenyl)-1,3,4-thiadiazol-2-amine, 97%, 97%, 5-(4-Nitro-phenyl)-[1,3,4]thiadiazol-2-ylamine, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 25g.
5-(4-nitrophenyl)-1,3,4-thiadiazol-2-amine (CAS 833-63-6) is a chemical compound with the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. IUPAC name: 5-(4-nitrophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: XAPNDVNSXWXPJS-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2S |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | XAPNDVNSXWXPJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)