Products 1311314-60-9
CAS 1311314-60-9 is the registry number for 4H-​(1,​2,​4)​Triazolo(5,​1-​c)​(1,​2,​4)​benzothiadiazine 5,​5-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazine 5,5-dioxide (CAS 1311314-60-9) is a chemical compound with the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. IUPAC name: 4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazine 5,5-dioxide. InChIKey: KVUKFMLHDLSLSM-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2S |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | 4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazine 5,5-dioxide |
| InChIKey | KVUKFMLHDLSLSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N3C(=NC=N3)NS2(=O)=O |
Computed by PubChem (NCBI)