CAS 833-47-6 appears in our catalog under these names: 5–(3–Nitrophenyl)–1,3,4–thiadiazol–2–amine, 5-(3-Nitrophenyl)-1,3,4-thiadiazol-2-amine, 95%, 95%, 5-(3-Nitro-phenyl)-[1,3,4]thiadiazol-2-ylamine, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 250mg.
5-(3-nitrophenyl)-1,3,4-thiadiazol-2-amine (CAS 833-47-6) is a chemical compound with the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. IUPAC name: 5-(3-nitrophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: IQTFBFZCUYGFES-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2S |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | 5-(3-nitrophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | IQTFBFZCUYGFES-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NN=C(S2)N |
Computed by PubChem (NCBI)