Products 832-79-1
CAS 832-79-1 appears in our catalog under these names: 5-(2-Nitrophenyl)-1,3,4-thiadiazol-2-amine, 97%, 97%, 5-(2-Nitrophenyl)-1,3,4-thiadiazol-2-amine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-(2-nitrophenyl)-1,3,4-thiadiazol-2-amine (CAS 832-79-1) is a chemical compound with the molecular formula C8H6N4O2S and a molecular weight of 222.23 g/mol. IUPAC name: 5-(2-nitrophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: KEFOBHANGWVLMY-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2S |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | 5-(2-nitrophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | KEFOBHANGWVLMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(S2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)