CAS 1283180-16-4 is the registry number for 1-Bromo-3-(2,4-difluorophenyl)propan-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-bromo-3-(2,4-difluorophenyl)propan-2-one (CAS 1283180-16-4) is a chemical compound with the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. IUPAC name: 1-bromo-3-(2,4-difluorophenyl)propan-2-one. InChIKey: MFCJMMWQBNHTOL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 1-bromo-3-(2,4-difluorophenyl)propan-2-one |
| InChIKey | MFCJMMWQBNHTOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC(=O)CBr |
Computed by PubChem (NCBI)