Products 1283720-38-6
CAS 1283720-38-6 is the registry number for 2,2,2-Trifluoro-1-(piperidin-2-yl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2,2-trifluoro-1-piperidin-2-ylethanol;hydrochloride (CAS 1283720-38-6) is a chemical compound with the molecular formula C7H13ClF3NO and a molecular weight of 219.63 g/mol. IUPAC name: 2,2,2-trifluoro-1-piperidin-2-ylethanol;hydrochloride. InChIKey: WPVSSMTUSPJGEI-UHFFFAOYSA-N.
| Molecular formula | C7H13ClF3NO |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-piperidin-2-ylethanol;hydrochloride |
| InChIKey | WPVSSMTUSPJGEI-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)