CAS 128837-33-2 is the registry number for 7,2',4'-Trihydroxyflavanone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-(2,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrochromen-4-one (CAS 128837-33-2) is a chemical compound with the molecular formula C15H12O5 and a molecular weight of 272.25 g/mol. IUPAC name: (2S)-2-(2,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrochromen-4-one. InChIKey: JBQATDIMBVLPRB-HNNXBMFYSA-N.
| Molecular formula | C15H12O5 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | (2S)-2-(2,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydrochromen-4-one |
| InChIKey | JBQATDIMBVLPRB-HNNXBMFYSA-N |
| SMILES | C1[C@H](OC2=C(C1=O)C=CC(=C2)O)C3=C(C=C(C=C3)O)O |
Computed by PubChem (NCBI)