Products 128915-56-0
CAS 128915-56-0 appears in our catalog under these names: Asenapine Impurity 3 (N-Desmethyl Asenapine), N–desmethyl Asenapine, N-Desmethyl asenapine, N-Desmethyl Asenapine-d4. Offered by: Hubei YoungXin, GLPBio, MedChemExpress, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 5 mg.
(2S,6S)-9-chloro-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene (CAS 128915-56-0) is a chemical compound with the molecular formula C16H14ClNO and a molecular weight of 271.74 g/mol. IUPAC name: (2S,6S)-9-chloro-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene. InChIKey: DQUCRGAOGUQHJQ-ZIAGYGMSSA-N.
| Molecular formula | C16H14ClNO |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | (2S,6S)-9-chloro-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene |
| InChIKey | DQUCRGAOGUQHJQ-ZIAGYGMSSA-N |
| SMILES | C1[C@H]2[C@H](CN1)C3=C(C=CC(=C3)Cl)OC4=CC=CC=C24 |
Computed by PubChem (NCBI)