CAS 25961-11-9 appears in our catalog under these names: Carbamazepine Impurity 1, Clomipramine Impurity 2, 5-Acetyl-3-chloroiminodibenzyl, >95% (HPLC), 5–Acetyl–3–chloro–10,11–dihydrodibenzo(b,f)azepine, 5-Acetyl-3-chloro-10,11-dihydrodibenzo[b,f]azepine, >98.0%(GC)(N). Offered by: Chemat Brand, TRC, GLPBio, TCI, Ambeed. Available pack sizes: on request, 1g, 100g, 25g, 5g, 500g.
1-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone (CAS 25961-11-9) is a chemical compound with the molecular formula C16H14ClNO and a molecular weight of 271.74 g/mol. IUPAC name: 1-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone. InChIKey: NMZOSOMVILZBJL-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 1-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone |
| InChIKey | NMZOSOMVILZBJL-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=CC=CC=C2CCC3=C1C=C(C=C3)Cl |
Computed by PubChem (NCBI)