Products 223735-93-1
CAS 223735-93-1 appears in our catalog under these names: WAY–300716, WAY-300716, ≥98%, ≥98%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 5mg.
(4-chlorophenyl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone (CAS 223735-93-1) is a chemical compound with the molecular formula C16H14ClNO and a molecular weight of 271.74 g/mol. IUPAC name: (4-chlorophenyl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone. InChIKey: AFLIBHSYRRBBBP-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | (4-chlorophenyl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| InChIKey | AFLIBHSYRRBBBP-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)