Products 92407-90-4
CAS 92407-90-4 is the registry number for Oncrasin-72, 97.61%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 25 mg, 100 mg, 5 mg.
[1-[(3-chlorophenyl)methyl]indol-3-yl]methanol (CAS 92407-90-4) is a chemical compound with the molecular formula C16H14ClNO and a molecular weight of 271.74 g/mol. IUPAC name: [1-[(3-chlorophenyl)methyl]indol-3-yl]methanol. InChIKey: LPIARNOLFFSUSO-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | [1-[(3-chlorophenyl)methyl]indol-3-yl]methanol |
| InChIKey | LPIARNOLFFSUSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC(=CC=C3)Cl)CO |
Computed by PubChem (NCBI)