CAS 3534-05-2 is the registry number for 5-(Chloroacetyl)-10,11-dihydro-5h-dibenzo[b,f]azepine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone (CAS 3534-05-2) is a chemical compound with the molecular formula C16H14ClNO and a molecular weight of 271.74 g/mol. IUPAC name: 2-chloro-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone. InChIKey: TXCPQCCKJNJBJU-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 2-chloro-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethanone |
| InChIKey | TXCPQCCKJNJBJU-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C3=CC=CC=C31)C(=O)CCl |
Computed by PubChem (NCBI)