CAS 1467060-56-5 is the registry number for 6-Chloro-5-(4-ethoxyphenyl)-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-chloro-5-(4-ethoxyphenyl)-1H-indole (CAS 1467060-56-5) is a chemical compound with the molecular formula C16H14ClNO and a molecular weight of 271.74 g/mol. IUPAC name: 6-chloro-5-(4-ethoxyphenyl)-1H-indole. InChIKey: XUOODZUIXJSLSF-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 6-chloro-5-(4-ethoxyphenyl)-1H-indole |
| InChIKey | XUOODZUIXJSLSF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=C(C=C3C(=C2)C=CN3)Cl |
Computed by PubChem (NCBI)