Products 2022940-56-1
CAS 2022940-56-1 is the registry number for 2-(3-Chloro-4-methoxyphenyl)-1-methyl-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chloro-4-methoxyphenyl)-1-methylindole (CAS 2022940-56-1) is a chemical compound with the molecular formula C16H14ClNO and a molecular weight of 271.74 g/mol. IUPAC name: 2-(3-chloro-4-methoxyphenyl)-1-methylindole. InChIKey: LWZZSEGPURVLCX-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 2-(3-chloro-4-methoxyphenyl)-1-methylindole |
| InChIKey | LWZZSEGPURVLCX-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C=C1C3=CC(=C(C=C3)OC)Cl |
Computed by PubChem (NCBI)