CAS 128979-15-7 appears in our catalog under these names: 4-Benzoyl-1,3-oxazole, 95%, 4-Benzoyl-1,3-oxazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,3-oxazol-4-yl(phenyl)methanone (CAS 128979-15-7) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 1,3-oxazol-4-yl(phenyl)methanone. InChIKey: LVSZVEDQGDOCBQ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 1,3-oxazol-4-yl(phenyl)methanone |
| InChIKey | LVSZVEDQGDOCBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=COC=N2 |
Computed by PubChem (NCBI)