CAS 129050-20-0 appears in our catalog under these names: 6–Fluoro–3,4–dihydro–2H–1–benzopyran–2–carboxylic acid, 6-Fluorochromane-2-Carboxylic Acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 50g, 100g.
6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 129050-20-0) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: ZNJANLXCXMVFFI-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | ZNJANLXCXMVFFI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)OC1C(=O)O |
Computed by PubChem (NCBI)