CAS 129101-37-7 appears in our catalog under these names: (R)-6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid, 98%, (R)–6–Fluorochroman–2–carboxylic acid, (R)-6-Fluorochroman-2-carboxylic acid, 95%, 95%, (R)-6-Fluorochroman-2-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
(2R)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 129101-37-7) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: (2R)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: ZNJANLXCXMVFFI-SECBINFHSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | (2R)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | ZNJANLXCXMVFFI-SECBINFHSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)O[C@H]1C(=O)O |
Computed by PubChem (NCBI)