CAS 129101-36-6 appears in our catalog under these names: (S)-6-Fluorochromane-2-carboxylic acid, 95%, (2S)-6-fluoro-3,4-dihydro-2H-1-Benzopyran-2-carboxylic acid, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
(2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 129101-36-6) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: ZNJANLXCXMVFFI-VIFPVBQESA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | ZNJANLXCXMVFFI-VIFPVBQESA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)O[C@@H]1C(=O)O |
Computed by PubChem (NCBI)