CAS 99199-60-7 appears in our catalog under these names: rac-6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic Acid, 6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid, 6-Fluorochroman-2-carboxylic Acid, >98.0%(GC)(T), 6-Fluorochroman-2-carboxylic Acid, 97%, 97%, 6-Fluorochromane-2-carboxylic acid, 95%. Offered by: TRC, Mikromol, Biosynth, TCI, Chemat. Available pack sizes: 10g, 25mg, 25g, 5g, 250mg, 1g, 100g.
6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 99199-60-7) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: ZNJANLXCXMVFFI-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | ZNJANLXCXMVFFI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)OC1C(=O)O |
Computed by PubChem (NCBI)