Products 1296172-36-5

CAS 1296172-36-5 is the registry number for Ethyl 3,5-dichloro-4-cyanopyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 3,5-dichloro-4-cyanopyridine-2-carboxylate (CAS 1296172-36-5) is a chemical compound with the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. IUPAC name: ethyl 3,5-dichloro-4-cyanopyridine-2-carboxylate. InChIKey: QCDKAYLLFNQOQY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Cl2N2O2
Molecular weight245.06 g/mol
IUPAC nameethyl 3,5-dichloro-4-cyanopyridine-2-carboxylate
InChIKeyQCDKAYLLFNQOQY-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC=C(C(=C1Cl)C#N)Cl

Computed by PubChem (NCBI)