CAS 1296172-36-5 is the registry number for Ethyl 3,5-dichloro-4-cyanopyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 3,5-dichloro-4-cyanopyridine-2-carboxylate (CAS 1296172-36-5) is a chemical compound with the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. IUPAC name: ethyl 3,5-dichloro-4-cyanopyridine-2-carboxylate. InChIKey: QCDKAYLLFNQOQY-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O2 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | ethyl 3,5-dichloro-4-cyanopyridine-2-carboxylate |
| InChIKey | QCDKAYLLFNQOQY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(C(=C1Cl)C#N)Cl |
Computed by PubChem (NCBI)