Products 601516-86-3
CAS 601516-86-3 is the registry number for 2,5-Dichloro-7-methoxy-4(3h)-quinazolinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,5-dichloro-7-methoxy-3H-quinazolin-4-one (CAS 601516-86-3) is a chemical compound with the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. IUPAC name: 2,5-dichloro-7-methoxy-3H-quinazolin-4-one. InChIKey: VQULVZJHJMUBLB-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O2 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | 2,5-dichloro-7-methoxy-3H-quinazolin-4-one |
| InChIKey | VQULVZJHJMUBLB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)Cl)C(=O)NC(=N2)Cl |
Computed by PubChem (NCBI)