CAS 871583-20-9 is the registry number for 4,6-Dichloro-1h-pyrrolo[3,2-c]pyridine-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl 4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS 871583-20-9) is a chemical compound with the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. IUPAC name: methyl 4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate. InChIKey: UTSLJBDIAXLXSH-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O2 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | methyl 4,6-dichloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate |
| InChIKey | UTSLJBDIAXLXSH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N=C(C=C2N1)Cl)Cl |
Computed by PubChem (NCBI)