CAS 2703752-88-7 is the registry number for Methyl 4,6-dichloropyrazolo[1,5-a]pyridine-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 4,6-dichloropyrazolo[1,5-a]pyridine-3-carboxylate (CAS 2703752-88-7) is a chemical compound with the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. IUPAC name: methyl 4,6-dichloropyrazolo[1,5-a]pyridine-3-carboxylate. InChIKey: YBSCVHOSHOOEQP-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O2 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | methyl 4,6-dichloropyrazolo[1,5-a]pyridine-3-carboxylate |
| InChIKey | YBSCVHOSHOOEQP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=CN2N=C1)Cl)Cl |
Computed by PubChem (NCBI)